C43H48N4O4 — CID 67809242
4,5-diphenyl-1H-imidazole;2-(2-methoxyethoxy)ethyl 8-(4,5-diphenylimidazol-1-yl)octanoate (PubChem CID 67809242) has the molecular formula C43H48N4O4 and a molecular weight of 684.88 g/mol. Its IUPAC name is 4,5-diphenyl-1H-imidazole;2-(2-methoxyethoxy)ethyl 8-(4,5-diphenylimidazol-1-yl)octanoate.
| Compound Name | 4,5-diphenyl-1H-imidazole;2-(2-methoxyethoxy)ethyl 8-(4,5-diphenylimidazol-1-yl)octanoate |
|---|---|
| PubChem CID | 67809242 |
| Molecular Formula | C43H48N4O4 |
| Molecular Weight | 684.88 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | 4,5-diphenyl-1H-imidazole;2-(2-methoxyethoxy)ethyl 8-(4,5-diphenylimidazol-1-yl)octanoate |
| SMILES | COCCOCCOC(=O)CCCCCCCn1cnc(-c2ccccc2)c1-c1ccccc1.c1ccc(-c2nc[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H36N2O4.C15H12N2/c1-32-19-20-33-21-22-34-26(31)17-11-3-2-4-12-18-30-23-29-27(24-13-7-5-8-14-24)28(30)25-15-9-6-10-16-25;1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h5-10,13-16,23H,2-4,11-12,17-22H2,1H3;1-11H,(H,16,17) |
| InChIKey | PFMXOGRAPCOWCD-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.88 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|