C37H42N2O12 — CID 67809272
[3,4,5-triacetyloxy-6-[4-[4-[2-[benzyl(methylcarbamoyl)amino]ethoxy]phenyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 67809272) has the molecular formula C37H42N2O12 and a molecular weight of 706.75 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-[4-[2-[benzyl(methylcarbamoyl)amino]ethoxy]phenyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-[4-[2-[benzyl(methylcarbamoyl)amino]ethoxy]phenyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67809272 |
| Molecular Formula | C37H42N2O12 |
| Molecular Weight | 706.75 g/mol |
| Exact Mass | 706.27 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-[4-[2-[benzyl(methylcarbamoyl)amino]ethoxy]phenyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CNC(=O)N(CCOc1ccc(-c2ccc(OC3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)cc2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H42N2O12/c1-23(40)46-22-32-33(47-24(2)41)34(48-25(3)42)35(49-26(4)43)36(51-32)50-31-17-13-29(14-18-31)28-11-15-30(16-12-28)45-20-19-39(37(44)38-5)21-27-9-7-6-8-10-27/h6-18,32-36H,19-22H2,1-5H3,(H,38,44) |
| InChIKey | JUJXHRIDNGFHCI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|