C28H35ClN4O8 — CID 67809341
(4S,12aR)-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6,9,10-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 67809341) has the molecular formula C28H35ClN4O8 and a molecular weight of 591.06 g/mol. Its IUPAC name is (4S,12aR)-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6,9,10-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6,9,10-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67809341 |
| Molecular Formula | C28H35ClN4O8 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | (4S,12aR)-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[(2-piperidin-1-ylacetyl)amino]-4a,5,5a,6,9,10-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)C4=C(C=C(Cl)C(NC(=O)CN5CCCCC5)C4O)CC3CC12 |
| InChI | InChI=1S/C28H35ClN4O8/c1-32(2)21-14-9-12-8-13-10-15(29)20(31-16(34)11-33-6-4-3-5-7-33)23(36)17(13)22(35)18(12)25(38)28(14,41)26(39)19(24(21)37)27(30)40/h10,12,14,20-21,23,35-36,39,41H,3-9,11H2,1-2H3,(H2,30,40)(H,31,34)/t12?,14?,20?,21-,23?,28-/m0/s1 |
| InChIKey | HTYYAJQENODHSM-JIWRVDIBSA-N |
| XLogP | -0.29 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|