C18H26ClN3O4 — CID 67810790
(2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 67810790) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67810790 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (2S)-N-[2-(3,4-dihydroxyphenyl)ethyl]-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCc1ccc(O)c(O)c1)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H25N3O4.ClH/c22-15-6-5-12(11-16(15)23)7-9-20-17(24)14-4-2-10-21(14)18(25)13-3-1-8-19-13;/h5-6,11,13-14,19,22-23H,1-4,7-10H2,(H,20,24);1H/t13-,14-;/m0./s1 |
| InChIKey | BYHXBLUXSGHTJS-IODNYQNNSA-N |
| XLogP | 0.92 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|