C14H24O6 — CID 67812445
6-(1-ethoxyethoxy)-3a-(hydroxymethyl)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one (PubChem CID 67812445) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 6-(1-ethoxyethoxy)-3a-(hydroxymethyl)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one.
| Compound Name | 6-(1-ethoxyethoxy)-3a-(hydroxymethyl)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 67812445 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-(1-ethoxyethoxy)-3a-(hydroxymethyl)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one |
| SMILES | CCOC(C)OC1CC(=O)C2(CO)OCOC2(C)C1C |
| InChI | InChI=1S/C14H24O6/c1-5-17-10(3)20-11-6-12(16)14(7-15)13(4,9(11)2)18-8-19-14/h9-11,15H,5-8H2,1-4H3 |
| InChIKey | BKNPSNIQEFQESH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|