C13H15N3O2S — CID 67813078
2-(2-oxo-2-piperazin-1-ylethyl)-1,2-benzothiazol-3-one (PubChem CID 67813078) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(2-oxo-2-piperazin-1-ylethyl)-1,2-benzothiazol-3-one.
| Compound Name | 2-(2-oxo-2-piperazin-1-ylethyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 67813078 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-(2-oxo-2-piperazin-1-ylethyl)-1,2-benzothiazol-3-one |
| SMILES | O=C(Cn1sc2ccccc2c1=O)N1CCNCC1 |
| InChI | InChI=1S/C13H15N3O2S/c17-12(15-7-5-14-6-8-15)9-16-13(18)10-3-1-2-4-11(10)19-16/h1-4,14H,5-9H2 |
| InChIKey | XKMKJBJSOINLRY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |