C11H20ClNO4 — CID 67813181
(E)-but-2-enedioic acid;1,2-dimethylpiperidine;hydrochloride (PubChem CID 67813181) has the molecular formula C11H20ClNO4 and a molecular weight of 265.74 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1,2-dimethylpiperidine;hydrochloride.
| Compound Name | (E)-but-2-enedioic acid;1,2-dimethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 67813181 |
| Molecular Formula | C11H20ClNO4 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (E)-but-2-enedioic acid;1,2-dimethylpiperidine;hydrochloride |
| SMILES | CC1CCCCN1C.Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C7H15N.C4H4O4.ClH/c1-7-5-3-4-6-8(7)2;5-3(6)1-2-4(7)8;/h7H,3-6H2,1-2H3;1-2H,(H,5,6)(H,7,8);1H/b;2-1+; |
| InChIKey | LNGPNSKXOSUUNU-JITBQSAISA-N |
| XLogP | 1.62 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|