C11H17NO4 — CID 67948118
but-2-enedioic acid;1-methyl-4-methylidenepiperidine (PubChem CID 67948118) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is but-2-enedioic acid;1-methyl-4-methylidenepiperidine.
| Compound Name | but-2-enedioic acid;1-methyl-4-methylidenepiperidine |
|---|---|
| PubChem CID | 67948118 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | but-2-enedioic acid;1-methyl-4-methylidenepiperidine |
| SMILES | C=C1CCN(C)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C7H13N.C4H4O4/c1-7-3-5-8(2)6-4-7;5-3(6)1-2-4(7)8/h1,3-6H2,2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | XOTJYKGIHUJORG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|