C9H12N2OS — CID 67814094
4-pentyl-6-oxa-7-thia-2,8-diazabicyclo[3.2.1]octa-1,3,5(8)-triene (PubChem CID 67814094) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 4-pentyl-6-oxa-7-thia-2,8-diazabicyclo[3.2.1]octa-1,3,5(8)-triene.
| Compound Name | 4-pentyl-6-oxa-7-thia-2,8-diazabicyclo[3.2.1]octa-1,3,5(8)-triene |
|---|---|
| PubChem CID | 67814094 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-pentyl-6-oxa-7-thia-2,8-diazabicyclo[3.2.1]octa-1,3,5(8)-triene |
| SMILES | CCCCCc1cnc2nc1OS2 |
| InChI | InChI=1S/C9H12N2OS/c1-2-3-4-5-7-6-10-9-11-8(7)12-13-9/h6H,2-5H2,1H3 |
| InChIKey | DUYQVIZSDMGFLS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|