C26H20N4 — CID 67814155
2,6-dipyridin-2-yl-4-[4-(1H-pyrrol-2-ylmethyl)phenyl]pyridine (PubChem CID 67814155) has the molecular formula C26H20N4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2,6-dipyridin-2-yl-4-[4-(1H-pyrrol-2-ylmethyl)phenyl]pyridine.
| Compound Name | 2,6-dipyridin-2-yl-4-[4-(1H-pyrrol-2-ylmethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 67814155 |
| Molecular Formula | C26H20N4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2,6-dipyridin-2-yl-4-[4-(1H-pyrrol-2-ylmethyl)phenyl]pyridine |
| SMILES | c1ccc(-c2cc(-c3ccc(Cc4ccc[nH]4)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C26H20N4/c1-3-13-28-23(7-1)25-17-21(18-26(30-25)24-8-2-4-14-29-24)20-11-9-19(10-12-20)16-22-6-5-15-27-22/h1-15,17-18,27H,16H2 |
| InChIKey | CCQJHUNOHHCOAR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |