[4-(2-hydroxyacetyl)phenyl]boronic acid

C8H9BO4 — CID 67818650

IUPAC[4-(2-hydroxyacetyl)phenyl]boronic acid
SMILESO=C(CO)c1ccc(B(O)O)cc1
InChIInChI=1S/C8H9BO4/c10-5-8(11)6-1-3-7(4-2-6)9(12)13/h1-4,10,12-13H,5H2
InChIKeyQMVZPUFRUBMACK-UHFFFAOYSA-N
MW179.97 g/mol
LogP-1.46
Rot. Bonds3

About [4-(2-hydroxyacetyl)phenyl]boronic acid

[4-(2-hydroxyacetyl)phenyl]boronic acid (PubChem CID 67818650) has the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. Its IUPAC name is [4-(2-hydroxyacetyl)phenyl]boronic acid.

Molecular Properties

Compound Name[4-(2-hydroxyacetyl)phenyl]boronic acid
PubChem CID67818650
Molecular FormulaC8H9BO4
Molecular Weight179.97 g/mol
Exact Mass180.06
IUPAC Name[4-(2-hydroxyacetyl)phenyl]boronic acid
SMILESO=C(CO)c1ccc(B(O)O)cc1
InChIInChI=1S/C8H9BO4/c10-5-8(11)6-1-3-7(4-2-6)9(12)13/h1-4,10,12-13H,5H2
InChIKeyQMVZPUFRUBMACK-UHFFFAOYSA-N
XLogP-1.46
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.97
LogP ≤ 5-1.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(2-hydroxyacetyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(2-hydroxyacetyl)phenyl]boronic acid?
The IUPAC name of [4-(2-hydroxyacetyl)phenyl]boronic acid (CID 67818650) is [4-(2-hydroxyacetyl)phenyl]boronic acid.
What is the SMILES notation for [4-(2-hydroxyacetyl)phenyl]boronic acid?
The canonical SMILES for [4-(2-hydroxyacetyl)phenyl]boronic acid is O=C(CO)c1ccc(B(O)O)cc1.
What is the InChIKey of [4-(2-hydroxyacetyl)phenyl]boronic acid?
The InChIKey is QMVZPUFRUBMACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO4/c10-5-8(11)6-1-3-7(4-2-6)9(12)13/h1-4,10,12-13H,5H2.
What are the key properties of [4-(2-hydroxyacetyl)phenyl]boronic acid?
[4-(2-hydroxyacetyl)phenyl]boronic acid has a molecular weight of 179.97 g/mol, XLogP of -1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-hydroxyacetyl)phenyl]boronic acid is sourced from PubChem (CID 67818650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).