C22H26N6O5S — CID 67819700
ethyl 2-[4-[1-(butylamino)-3-hydrazinyl-1,3-dioxopropan-2-yl]sulfanyl-2-hydroxyphenyl]benzotriazole-5-carboxylate (PubChem CID 67819700) has the molecular formula C22H26N6O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is ethyl 2-[4-[1-(butylamino)-3-hydrazinyl-1,3-dioxopropan-2-yl]sulfanyl-2-hydroxyphenyl]benzotriazole-5-carboxylate.
| Compound Name | ethyl 2-[4-[1-(butylamino)-3-hydrazinyl-1,3-dioxopropan-2-yl]sulfanyl-2-hydroxyphenyl]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 67819700 |
| Molecular Formula | C22H26N6O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | ethyl 2-[4-[1-(butylamino)-3-hydrazinyl-1,3-dioxopropan-2-yl]sulfanyl-2-hydroxyphenyl]benzotriazole-5-carboxylate |
| SMILES | CCCCNC(=O)C(Sc1ccc(-n2nc3ccc(C(=O)OCC)cc3n2)c(O)c1)C(=O)NN |
| InChI | InChI=1S/C22H26N6O5S/c1-3-5-10-24-20(30)19(21(31)25-23)34-14-7-9-17(18(29)12-14)28-26-15-8-6-13(11-16(15)27-28)22(32)33-4-2/h6-9,11-12,19,29H,3-5,10,23H2,1-2H3,(H,24,30)(H,25,31) |
| InChIKey | PNMBXKQNRNPWDX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 161.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|