C21H40O6 — CID 67821016
(1R)-1-[(3aS,4R,6R,6aS)-2,2-dimethyl-4-(1-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanol (PubChem CID 67821016) has the molecular formula C21H40O6 and a molecular weight of 388.55 g/mol. Its IUPAC name is (1R)-1-[(3aS,4R,6R,6aS)-2,2-dimethyl-4-(1-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanol.
| Compound Name | (1R)-1-[(3aS,4R,6R,6aS)-2,2-dimethyl-4-(1-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanol |
|---|---|
| PubChem CID | 67821016 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (1R)-1-[(3aS,4R,6R,6aS)-2,2-dimethyl-4-(1-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethanol |
| SMILES | CCCCCCCCCOC(CC)O[C@H]1O[C@H]([C@@H](C)O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C21H40O6/c1-6-8-9-10-11-12-13-14-23-16(7-2)24-20-19-18(17(25-20)15(3)22)26-21(4,5)27-19/h15-20,22H,6-14H2,1-5H3/t15-,16?,17-,18+,19+,20+/m1/s1 |
| InChIKey | KJSOLEHTMLEMCN-CWOXYDIHSA-N |
| XLogP | 4.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|