C25H27N3O2S — CID 67821426
2-methyl-5-[(2-methylbenzimidazol-2-yl)methyl]-N-(3-phenylpropyl)benzenesulfonamide (PubChem CID 67821426) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-methyl-5-[(2-methylbenzimidazol-2-yl)methyl]-N-(3-phenylpropyl)benzenesulfonamide.
| Compound Name | 2-methyl-5-[(2-methylbenzimidazol-2-yl)methyl]-N-(3-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67821426 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-methyl-5-[(2-methylbenzimidazol-2-yl)methyl]-N-(3-phenylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(CC2(C)N=c3ccccc3=N2)cc1S(=O)(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C25H27N3O2S/c1-19-14-15-21(18-25(2)27-22-12-6-7-13-23(22)28-25)17-24(19)31(29,30)26-16-8-11-20-9-4-3-5-10-20/h3-7,9-10,12-15,17,26H,8,11,16,18H2,1-2H3 |
| InChIKey | VRHYGMMFGIILPZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|