C52H82O6 — CID 67826302
diethyl (2R,3R)-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]phenyl]methoxy]butanedioate (PubChem CID 67826302) has the molecular formula C52H82O6 and a molecular weight of 803.22 g/mol. Its IUPAC name is diethyl (2R,3R)-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]phenyl]methoxy]butanedioate.
| Compound Name | diethyl (2R,3R)-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]phenyl]methoxy]butanedioate |
|---|---|
| PubChem CID | 67826302 |
| Molecular Formula | C52H82O6 |
| Molecular Weight | 803.22 g/mol |
| Exact Mass | 802.61 |
| IUPAC Name | diethyl (2R,3R)-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]phenyl]methoxy]butanedioate |
| SMILES | CCCCCC1CCC(CCCCc2ccc(CO[C@@H](C(=O)OCC)[C@@H](OCc3ccc(CCCCC4CCC(CCCCC)CC4)cc3)C(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C52H82O6/c1-5-9-11-17-41-23-27-43(28-24-41)19-13-15-21-45-31-35-47(36-32-45)39-57-49(51(53)55-7-3)50(52(54)56-8-4)58-40-48-37-33-46(34-38-48)22-16-14-20-44-29-25-42(26-30-44)18-12-10-6-2/h31-38,41-44,49-50H,5-30,39-40H2,1-4H3/t41?,42?,43?,44?,49-,50-/m1/s1 |
| InChIKey | MKHMPOSISLDXJJ-GKSFQWJWSA-N |
| XLogP | 13.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.22 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|