C19H16ClNO2 — CID 67826530
2-chloro-3-(1-phenylpropan-2-ylamino)naphthalene-1,4-dione (PubChem CID 67826530) has the molecular formula C19H16ClNO2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-3-(1-phenylpropan-2-ylamino)naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(1-phenylpropan-2-ylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 67826530 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-chloro-3-(1-phenylpropan-2-ylamino)naphthalene-1,4-dione |
| SMILES | CC(Cc1ccccc1)NC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16ClNO2/c1-12(11-13-7-3-2-4-8-13)21-17-16(20)18(22)14-9-5-6-10-15(14)19(17)23/h2-10,12,21H,11H2,1H3 |
| InChIKey | OSFRAGGLNBFYDV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|