(2,3,4-trimethylphenyl)methoxyboronic acid

C10H15BO3 — CID 67826553

IUPAC(2,3,4-trimethylphenyl)methoxyboronic acid
SMILESCc1ccc(COB(O)O)c(C)c1C
InChIInChI=1S/C10H15BO3/c1-7-4-5-10(6-14-11(12)13)9(3)8(7)2/h4-5,12-13H,6H2,1-3H3
InChIKeyUASFAKMGHHQILV-UHFFFAOYSA-N
MW194.04 g/mol
LogP1.10
Rot. Bonds3

About (2,3,4-trimethylphenyl)methoxyboronic acid

(2,3,4-trimethylphenyl)methoxyboronic acid (PubChem CID 67826553) has the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. Its IUPAC name is (2,3,4-trimethylphenyl)methoxyboronic acid.

Molecular Properties

Compound Name(2,3,4-trimethylphenyl)methoxyboronic acid
PubChem CID67826553
Molecular FormulaC10H15BO3
Molecular Weight194.04 g/mol
Exact Mass194.11
IUPAC Name(2,3,4-trimethylphenyl)methoxyboronic acid
SMILESCc1ccc(COB(O)O)c(C)c1C
InChIInChI=1S/C10H15BO3/c1-7-4-5-10(6-14-11(12)13)9(3)8(7)2/h4-5,12-13H,6H2,1-3H3
InChIKeyUASFAKMGHHQILV-UHFFFAOYSA-N
XLogP1.10
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.04
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,3,4-trimethylphenyl)methoxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3,4-trimethylphenyl)methoxyboronic acid?
The IUPAC name of (2,3,4-trimethylphenyl)methoxyboronic acid (CID 67826553) is (2,3,4-trimethylphenyl)methoxyboronic acid.
What is the SMILES notation for (2,3,4-trimethylphenyl)methoxyboronic acid?
The canonical SMILES for (2,3,4-trimethylphenyl)methoxyboronic acid is Cc1ccc(COB(O)O)c(C)c1C.
What is the InChIKey of (2,3,4-trimethylphenyl)methoxyboronic acid?
The InChIKey is UASFAKMGHHQILV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BO3/c1-7-4-5-10(6-14-11(12)13)9(3)8(7)2/h4-5,12-13H,6H2,1-3H3.
What are the key properties of (2,3,4-trimethylphenyl)methoxyboronic acid?
(2,3,4-trimethylphenyl)methoxyboronic acid has a molecular weight of 194.04 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,4-trimethylphenyl)methoxyboronic acid is sourced from PubChem (CID 67826553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).