C10H15BO3 — CID 67826553
(2,3,4-trimethylphenyl)methoxyboronic acid (PubChem CID 67826553) has the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. Its IUPAC name is (2,3,4-trimethylphenyl)methoxyboronic acid.
| Compound Name | (2,3,4-trimethylphenyl)methoxyboronic acid |
|---|---|
| PubChem CID | 67826553 |
| Molecular Formula | C10H15BO3 |
| Molecular Weight | 194.04 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2,3,4-trimethylphenyl)methoxyboronic acid |
| SMILES | Cc1ccc(COB(O)O)c(C)c1C |
| InChI | InChI=1S/C10H15BO3/c1-7-4-5-10(6-14-11(12)13)9(3)8(7)2/h4-5,12-13H,6H2,1-3H3 |
| InChIKey | UASFAKMGHHQILV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.04 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|