C21H28N2O6S — CID 67827519
(2,6-dimethoxyphenyl)-[[2,6-di(propan-2-yl)phenyl]carbamoyl]sulfamic acid (PubChem CID 67827519) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-[[2,6-di(propan-2-yl)phenyl]carbamoyl]sulfamic acid.
| Compound Name | (2,6-dimethoxyphenyl)-[[2,6-di(propan-2-yl)phenyl]carbamoyl]sulfamic acid |
|---|---|
| PubChem CID | 67827519 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (2,6-dimethoxyphenyl)-[[2,6-di(propan-2-yl)phenyl]carbamoyl]sulfamic acid |
| SMILES | COc1cccc(OC)c1N(C(=O)Nc1c(C(C)C)cccc1C(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C21H28N2O6S/c1-13(2)15-9-7-10-16(14(3)4)19(15)22-21(24)23(30(25,26)27)20-17(28-5)11-8-12-18(20)29-6/h7-14H,1-6H3,(H,22,24)(H,25,26,27) |
| InChIKey | ULVFTXAZYWUJFG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|