C19H34N2O4 — CID 67827979
butane;1,1-diethoxyethane;(E)-1-(4-methylphenyl)-2-nitroethenamine (PubChem CID 67827979) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is butane;1,1-diethoxyethane;(E)-1-(4-methylphenyl)-2-nitroethenamine.
| Compound Name | butane;1,1-diethoxyethane;(E)-1-(4-methylphenyl)-2-nitroethenamine |
|---|---|
| PubChem CID | 67827979 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | butane;1,1-diethoxyethane;(E)-1-(4-methylphenyl)-2-nitroethenamine |
| SMILES | CCCC.CCOC(C)OCC.Cc1ccc(/C(N)=C\[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H10N2O2.C6H14O2.C4H10/c1-7-2-4-8(5-3-7)9(10)6-11(12)13;1-4-7-6(3)8-5-2;1-3-4-2/h2-6H,10H2,1H3;6H,4-5H2,1-3H3;3-4H2,1-2H3/b9-6+;; |
| InChIKey | IZBPCTFKWHFNLZ-SWSRPJROSA-N |
| XLogP | 4.74 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|