C21H30O7 — CID 67828726
2-hydroxy-1-[(8S,9S,10R,11S,13S,14S,16R,17R)-3,3,11,16,17-pentahydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 67828726) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-hydroxy-1-[(8S,9S,10R,11S,13S,14S,16R,17R)-3,3,11,16,17-pentahydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-hydroxy-1-[(8S,9S,10R,11S,13S,14S,16R,17R)-3,3,11,16,17-pentahydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 67828726 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-hydroxy-1-[(8S,9S,10R,11S,13S,14S,16R,17R)-3,3,11,16,17-pentahydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@]12C=CC(O)(O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@@H](O)[C@@]2(O)C(=O)CO |
| InChI | InChI=1S/C21H30O7/c1-18-5-6-20(26,27)8-11(18)3-4-12-13-7-15(24)21(28,16(25)10-22)19(13,2)9-14(23)17(12)18/h5-6,8,12-15,17,22-24,26-28H,3-4,7,9-10H2,1-2H3/t12-,13-,14-,15+,17+,18-,19-,21+/m0/s1 |
| InChIKey | MWOHHQKFMRMCNF-QZSACAIQSA-N |
| XLogP | -0.36 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|