C14H15Cl2N3O2 — CID 67832759
1-(2,4-dichlorophenyl)-1-(oxolan-2-yl)-2-(1,2,4-triazol-1-yl)ethanol (PubChem CID 67832759) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-1-(oxolan-2-yl)-2-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | 1-(2,4-dichlorophenyl)-1-(oxolan-2-yl)-2-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 67832759 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-1-(oxolan-2-yl)-2-(1,2,4-triazol-1-yl)ethanol |
| SMILES | OC(Cn1cncn1)(c1ccc(Cl)cc1Cl)C1CCCO1 |
| InChI | InChI=1S/C14H15Cl2N3O2/c15-10-3-4-11(12(16)6-10)14(20,13-2-1-5-21-13)7-19-9-17-8-18-19/h3-4,6,8-9,13,20H,1-2,5,7H2 |
| InChIKey | POYUAOMSSAVJMR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |