C25H31N7O — CID 67833895
4-butyl-5-methyl-1-pentyl-3-[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]imidazol-2-one (PubChem CID 67833895) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-butyl-5-methyl-1-pentyl-3-[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]imidazol-2-one.
| Compound Name | 4-butyl-5-methyl-1-pentyl-3-[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 67833895 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 4-butyl-5-methyl-1-pentyl-3-[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]imidazol-2-one |
| SMILES | CCCCCn1c(C)c(CCCC)n(-c2ccc(-c3ncccc3-c3nn[nH]n3)cc2)c1=O |
| InChI | InChI=1S/C25H31N7O/c1-4-6-8-17-31-18(3)22(11-7-5-2)32(25(31)33)20-14-12-19(13-15-20)23-21(10-9-16-26-23)24-27-29-30-28-24/h9-10,12-16H,4-8,11,17H2,1-3H3,(H,27,28,29,30) |
| InChIKey | LORKPAFBLIEOJT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|