C30H54O5Si2 — CID 67838141
(4R,6R)-6-[2-[(1S,2S,6S,8R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one (PubChem CID 67838141) has the molecular formula C30H54O5Si2 and a molecular weight of 550.93 g/mol. Its IUPAC name is (4R,6R)-6-[2-[(1S,2S,6S,8R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one.
| Compound Name | (4R,6R)-6-[2-[(1S,2S,6S,8R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
|---|---|
| PubChem CID | 67838141 |
| Molecular Formula | C30H54O5Si2 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | (4R,6R)-6-[2-[(1S,2S,6S,8R,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxan-2-one |
| SMILES | C[C@H]1C=CC2=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](O)[C@@H]2[C@H]1CC[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C30H54O5Si2/c1-20-12-13-21-16-23(34-36(8,9)29(2,3)4)18-26(31)28(21)25(20)15-14-22-17-24(19-27(32)33-22)35-37(10,11)30(5,6)7/h12-13,16,20,22-26,28,31H,14-15,17-19H2,1-11H3/t20-,22+,23+,24+,25-,26+,28-/m0/s1 |
| InChIKey | IMFPBWYNVCYKKK-WASQYMQQSA-N |
| XLogP | 7.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|