C38H70O5Si2 — CID 67812885
4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[6-[tert-butyl(dimethyl)silyl]oxy-8-(2-ethyl-2-methylpentoxy)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-2-one (PubChem CID 67812885) has the molecular formula C38H70O5Si2 and a molecular weight of 663.15 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[6-[tert-butyl(dimethyl)silyl]oxy-8-(2-ethyl-2-methylpentoxy)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-2-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[6-[tert-butyl(dimethyl)silyl]oxy-8-(2-ethyl-2-methylpentoxy)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-2-one |
|---|---|
| PubChem CID | 67812885 |
| Molecular Formula | C38H70O5Si2 |
| Molecular Weight | 663.15 g/mol |
| Exact Mass | 662.48 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-6-[2-[6-[tert-butyl(dimethyl)silyl]oxy-8-(2-ethyl-2-methylpentoxy)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-2-one |
| SMILES | CCCC(C)(CC)COC1CC(O[Si](C)(C)C(C)(C)C)C=C2C=CC(C)C(CCC3CC(O[Si](C)(C)C(C)(C)C)CC(=O)O3)C21 |
| InChI | InChI=1S/C38H70O5Si2/c1-15-21-38(10,16-2)26-40-33-24-30(42-44(11,12)36(4,5)6)22-28-18-17-27(3)32(35(28)33)20-19-29-23-31(25-34(39)41-29)43-45(13,14)37(7,8)9/h17-18,22,27,29-33,35H,15-16,19-21,23-26H2,1-14H3 |
| InChIKey | KMEGETSPOBJTPN-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.15 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|