C26H25N5O5 — CID 67840257
(Z)-but-2-enedioic acid;2-[(4-cyanophenyl)methyl]-1-[3-[(4-methoxyphenyl)methyl]-2-pyridinyl]guanidine (PubChem CID 67840257) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[(4-cyanophenyl)methyl]-1-[3-[(4-methoxyphenyl)methyl]-2-pyridinyl]guanidine.
| Compound Name | (Z)-but-2-enedioic acid;2-[(4-cyanophenyl)methyl]-1-[3-[(4-methoxyphenyl)methyl]-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 67840257 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[(4-cyanophenyl)methyl]-1-[3-[(4-methoxyphenyl)methyl]-2-pyridinyl]guanidine |
| SMILES | COc1ccc(Cc2cccnc2N/C(N)=N/Cc2ccc(C#N)cc2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H21N5O.C4H4O4/c1-28-20-10-8-16(9-11-20)13-19-3-2-12-25-21(19)27-22(24)26-15-18-6-4-17(14-23)5-7-18;5-3(6)1-2-4(7)8/h2-12H,13,15H2,1H3,(H3,24,25,26,27);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CJIXIABQBOOVSZ-BTJKTKAUSA-N |
| XLogP | 3.19 |
| TPSA | 170.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|