C19H22N4 — CID 111052309
2-[(4-cyanophenyl)methyl]-1-(2,6-diethylphenyl)guanidine (PubChem CID 111052309) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methyl]-1-(2,6-diethylphenyl)guanidine.
| Compound Name | 2-[(4-cyanophenyl)methyl]-1-(2,6-diethylphenyl)guanidine |
|---|---|
| PubChem CID | 111052309 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[(4-cyanophenyl)methyl]-1-(2,6-diethylphenyl)guanidine |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H22N4/c1-3-16-6-5-7-17(4-2)18(16)23-19(21)22-13-15-10-8-14(12-20)9-11-15/h5-11H,3-4,13H2,1-2H3,(H3,21,22,23) |
| InChIKey | QEIJUNGCCWJJLC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|