C18H22FN3O — CID 111817018
1-(2,6-diethylphenyl)-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine (PubChem CID 111817018) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine.
| Compound Name | 1-(2,6-diethylphenyl)-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111817018 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/Cc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C18H22FN3O/c1-3-13-6-5-7-14(4-2)17(13)22-18(20)21-11-12-8-9-16(23)15(19)10-12/h5-10,23H,3-4,11H2,1-2H3,(H3,20,21,22) |
| InChIKey | UTCREDGNXVGKBF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|