C27H45NO2 — CID 67840374
(1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-amino-7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol (PubChem CID 67840374) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is (1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-amino-7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol.
| Compound Name | (1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-amino-7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol |
|---|---|
| PubChem CID | 67840374 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | (1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-amino-7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-ol |
| SMILES | CC(C)CC[C@H]1O[C@H]2C[C@H]3[C@@H]4CC=C5CC(N)(O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C27H45NO2/c1-16(2)6-9-22-17(3)24-23(30-22)14-21-19-8-7-18-15-27(28,29)13-12-25(18,4)20(19)10-11-26(21,24)5/h7,16-17,19-24,29H,6,8-15,28H2,1-5H3/t17-,19-,20+,21+,22-,23+,24+,25+,26+,27?/m1/s1 |
| InChIKey | PLJCRWCMDNBURA-WMWQDACXSA-N |
| XLogP | 5.66 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|