C10H5I2NO3 — CID 67840682
5-hydroxy-7,8-diiodo-1H-1-benzazepine-2,3-dione (PubChem CID 67840682) has the molecular formula C10H5I2NO3 and a molecular weight of 440.96 g/mol. Its IUPAC name is 5-hydroxy-7,8-diiodo-1H-1-benzazepine-2,3-dione.
| Compound Name | 5-hydroxy-7,8-diiodo-1H-1-benzazepine-2,3-dione |
|---|---|
| PubChem CID | 67840682 |
| Molecular Formula | C10H5I2NO3 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.84 |
| IUPAC Name | 5-hydroxy-7,8-diiodo-1H-1-benzazepine-2,3-dione |
| SMILES | O=c1cc(O)c2cc(I)c(I)cc2[nH]c1=O |
| InChI | InChI=1S/C10H5I2NO3/c11-5-1-4-7(2-6(5)12)13-10(16)9(15)3-8(4)14/h1-3,14H,(H,13,15,16) |
| InChIKey | FJCIKPITVHUPME-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|