C9H4F3NO2 — CID 68614038
5,6,7-trifluoro-3-hydroxy-1H-quinolin-2-one (PubChem CID 68614038) has the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. Its IUPAC name is 5,6,7-trifluoro-3-hydroxy-1H-quinolin-2-one.
| Compound Name | 5,6,7-trifluoro-3-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68614038 |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 5,6,7-trifluoro-3-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(F)c(F)c(F)c2cc1O |
| InChI | InChI=1S/C9H4F3NO2/c10-4-2-5-3(7(11)8(4)12)1-6(14)9(15)13-5/h1-2,14H,(H,13,15) |
| InChIKey | MDNGBBOXUMLFRZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|