C20H28O4 — CID 67841151
[2-methoxy-4-[(E)-prop-1-enyl]phenyl] 2-hydroxy-2-prop-2-enylheptanoate (PubChem CID 67841151) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 2-hydroxy-2-prop-2-enylheptanoate.
| Compound Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 2-hydroxy-2-prop-2-enylheptanoate |
|---|---|
| PubChem CID | 67841151 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 2-hydroxy-2-prop-2-enylheptanoate |
| SMILES | C=CCC(O)(CCCCC)C(=O)Oc1ccc(/C=C/C)cc1OC |
| InChI | InChI=1S/C20H28O4/c1-5-8-9-14-20(22,13-7-3)19(21)24-17-12-11-16(10-6-2)15-18(17)23-4/h6-7,10-12,15,22H,3,5,8-9,13-14H2,1-2,4H3/b10-6+ |
| InChIKey | AKQRFTVNAWWESK-UXBLZVDNSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|