C27H35N3O2 — CID 67842032
2-[2-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetic acid (PubChem CID 67842032) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-[2-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetic acid.
| Compound Name | 2-[2-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67842032 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2-[2-ethyl-3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetic acid |
| SMILES | CCc1c(CCN2CCN(c3ccccc3C(C)C)CC2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C27H35N3O2/c1-4-24-23(22-10-6-8-12-26(22)30(24)19-27(31)32)13-14-28-15-17-29(18-16-28)25-11-7-5-9-21(25)20(2)3/h5-12,20H,4,13-19H2,1-3H3,(H,31,32) |
| InChIKey | APMMBQFMXVHCCX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|