C27H35N3O2 — CID 67842030
ethyl 2-[3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate (PubChem CID 67842030) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is ethyl 2-[3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 67842030 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | ethyl 2-[3-[2-[4-(2-propan-2-ylphenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(CCN2CCN(c3ccccc3C(C)C)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H35N3O2/c1-4-32-27(31)20-30-19-22(24-10-6-8-12-26(24)30)13-14-28-15-17-29(18-16-28)25-11-7-5-9-23(25)21(2)3/h5-12,19,21H,4,13-18,20H2,1-3H3 |
| InChIKey | RLJCFXVHVZNLHH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |