C24H27Cl2N3O2 — CID 139629685
ethyl 2-[3-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate (PubChem CID 139629685) has the molecular formula C24H27Cl2N3O2 and a molecular weight of 460.41 g/mol. Its IUPAC name is ethyl 2-[3-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 139629685 |
| Molecular Formula | C24H27Cl2N3O2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl 2-[3-[2-[4-(3,5-dichlorophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(CCN2CCN(c3cc(Cl)cc(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H27Cl2N3O2/c1-2-31-24(30)17-29-16-18(22-5-3-4-6-23(22)29)7-8-27-9-11-28(12-10-27)21-14-19(25)13-20(26)15-21/h3-6,13-16H,2,7-12,17H2,1H3 |
| InChIKey | FQTBNSHLRYFPMG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |