C24H28N4O4 — CID 139629760
ethyl 2-[3-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate (PubChem CID 139629760) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 2-[3-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 139629760 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | ethyl 2-[3-[2-[4-(2-nitrophenyl)piperazin-1-yl]ethyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(CCN2CCN(c3ccccc3[N+](=O)[O-])CC2)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O4/c1-2-32-24(29)18-27-17-19(20-7-3-4-8-21(20)27)11-12-25-13-15-26(16-14-25)22-9-5-6-10-23(22)28(30)31/h3-10,17H,2,11-16,18H2,1H3 |
| InChIKey | JUYAULLCJJIIBH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|