C10H6BrF2NO3PS+ — CID 67842601
[[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-fluoromethoxy]-hydroxy-oxophosphanium (PubChem CID 67842601) has the molecular formula C10H6BrF2NO3PS+ and a molecular weight of 369.10 g/mol. Its IUPAC name is [[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-fluoromethoxy]-hydroxy-oxophosphanium.
| Compound Name | [[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-fluoromethoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67842601 |
| Molecular Formula | C10H6BrF2NO3PS+ |
| Molecular Weight | 369.10 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | [[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-fluoromethoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OC(F)c1nc(-c2ccc(F)cc2)c(Br)s1 |
| InChI | InChI=1S/C10H5BrF2NO3PS/c11-8-7(5-1-3-6(12)4-2-5)14-10(19-8)9(13)17-18(15)16/h1-4,9H/p+1 |
| InChIKey | PSPKBOASYQUKQF-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.10 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|