C21H16BrF2NO3S — CID 67752847
5-bromo-4-(4-fluorophenyl)-2-(1-fluoro-2-phenylethenyl)-1,3-thiazole;3-methoxyprop-2-enoic acid (PubChem CID 67752847) has the molecular formula C21H16BrF2NO3S and a molecular weight of 480.33 g/mol. Its IUPAC name is 5-bromo-4-(4-fluorophenyl)-2-(1-fluoro-2-phenylethenyl)-1,3-thiazole;3-methoxyprop-2-enoic acid.
| Compound Name | 5-bromo-4-(4-fluorophenyl)-2-(1-fluoro-2-phenylethenyl)-1,3-thiazole;3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67752847 |
| Molecular Formula | C21H16BrF2NO3S |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | 5-bromo-4-(4-fluorophenyl)-2-(1-fluoro-2-phenylethenyl)-1,3-thiazole;3-methoxyprop-2-enoic acid |
| SMILES | COC=CC(=O)O.FC(=Cc1ccccc1)c1nc(-c2ccc(F)cc2)c(Br)s1 |
| InChI | InChI=1S/C17H10BrF2NS.C4H6O3/c18-16-15(12-6-8-13(19)9-7-12)21-17(22-16)14(20)10-11-4-2-1-3-5-11;1-7-3-2-4(5)6/h1-10H;2-3H,1H3,(H,5,6) |
| InChIKey | DZYWKPBOIHZQPY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|