C22H18F4N2O5 — CID 67752756
5-[1-fluoro-2-(2-methylphenyl)ethenyl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole;3-methoxyprop-2-enoic acid (PubChem CID 67752756) has the molecular formula C22H18F4N2O5 and a molecular weight of 466.39 g/mol. Its IUPAC name is 5-[1-fluoro-2-(2-methylphenyl)ethenyl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole;3-methoxyprop-2-enoic acid.
| Compound Name | 5-[1-fluoro-2-(2-methylphenyl)ethenyl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole;3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67752756 |
| Molecular Formula | C22H18F4N2O5 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 5-[1-fluoro-2-(2-methylphenyl)ethenyl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole;3-methoxyprop-2-enoic acid |
| SMILES | COC=CC(=O)O.Cc1ccccc1C=C(F)c1nc(-c2ccc(OC(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C18H12F4N2O2.C4H6O3/c1-11-4-2-3-5-13(11)10-15(19)17-23-16(24-26-17)12-6-8-14(9-7-12)25-18(20,21)22;1-7-3-2-4(5)6/h2-10H,1H3;2-3H,1H3,(H,5,6) |
| InChIKey | LFXXXGNDIJVBNM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|