C22H16BrF2NO3S — CID 77348215
methyl 2-[2-[2-[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 77348215) has the molecular formula C22H16BrF2NO3S and a molecular weight of 492.34 g/mol. Its IUPAC name is methyl 2-[2-[2-[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[2-[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 77348215 |
| Molecular Formula | C22H16BrF2NO3S |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | methyl 2-[2-[2-[5-bromo-4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1C=C(F)c1nc(-c2ccc(F)cc2)c(Br)s1 |
| InChI | InChI=1S/C22H16BrF2NO3S/c1-28-12-17(22(27)29-2)16-6-4-3-5-14(16)11-18(25)21-26-19(20(23)30-21)13-7-9-15(24)10-8-13/h3-12H,1-2H3 |
| InChIKey | AJAJFOIMJIUFEI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|