C21H19FN2O3S2 — CID 139629500
methyl 2-[2-[2-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 139629500) has the molecular formula C21H19FN2O3S2 and a molecular weight of 430.53 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[2-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 139629500 |
| Molecular Formula | C21H19FN2O3S2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | methyl 2-[2-[2-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CCc1nc(-c2nc(C(F)=Cc3ccccc3C(=COC)C(=O)OC)cs2)cs1 |
| InChI | InChI=1S/C21H19FN2O3S2/c1-4-19-23-18(12-28-19)20-24-17(11-29-20)16(22)9-13-7-5-6-8-14(13)15(10-26-2)21(25)27-3/h5-12H,4H2,1-3H3 |
| InChIKey | PNJRCZROKFYSET-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|