C22H16Cl2FNO3S — CID 67752211
methyl (E)-2-[2-[(E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 67752211) has the molecular formula C22H16Cl2FNO3S and a molecular weight of 464.35 g/mol. Its IUPAC name is methyl (E)-2-[2-[(E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[(E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 67752211 |
| Molecular Formula | C22H16Cl2FNO3S |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | methyl (E)-2-[2-[(E)-2-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1/C=C(/F)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C22H16Cl2FNO3S/c1-28-11-16(22(27)29-2)15-6-4-3-5-13(15)10-19(25)21-26-20(12-30-21)14-7-8-17(23)18(24)9-14/h3-12H,1-2H3/b16-11+,19-10+ |
| InChIKey | KHDZTQRFZHSLKH-GLHNYPDBSA-N |
| XLogP | 6.74 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|