C21H21FN2O3S2 — CID 67842595
2-ethyl-4-[4-[2-fluoro-1-(2-methylphenyl)ethenyl]-1,3-thiazol-2-yl]-1,3-thiazole;3-methoxyprop-2-enoic acid (PubChem CID 67842595) has the molecular formula C21H21FN2O3S2 and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-ethyl-4-[4-[2-fluoro-1-(2-methylphenyl)ethenyl]-1,3-thiazol-2-yl]-1,3-thiazole;3-methoxyprop-2-enoic acid.
| Compound Name | 2-ethyl-4-[4-[2-fluoro-1-(2-methylphenyl)ethenyl]-1,3-thiazol-2-yl]-1,3-thiazole;3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67842595 |
| Molecular Formula | C21H21FN2O3S2 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-ethyl-4-[4-[2-fluoro-1-(2-methylphenyl)ethenyl]-1,3-thiazol-2-yl]-1,3-thiazole;3-methoxyprop-2-enoic acid |
| SMILES | CCc1nc(-c2nc(C(=CF)c3ccccc3C)cs2)cs1.COC=CC(=O)O |
| InChI | InChI=1S/C17H15FN2S2.C4H6O3/c1-3-16-19-15(10-21-16)17-20-14(9-22-17)13(8-18)12-7-5-4-6-11(12)2;1-7-3-2-4(5)6/h4-10H,3H2,1-2H3;2-3H,1H3,(H,5,6) |
| InChIKey | HMCJANUYZKIVDE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|