C8H6IN3O2S2 — CID 163991093
iodo 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylate (PubChem CID 163991093) has the molecular formula C8H6IN3O2S2 and a molecular weight of 367.19 g/mol. Its IUPAC name is iodo 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | iodo 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 163991093 |
| Molecular Formula | C8H6IN3O2S2 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | iodo 2-[2-(aminomethyl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylate |
| SMILES | NCc1nc(-c2nc(C(=O)OI)cs2)cs1 |
| InChI | InChI=1S/C8H6IN3O2S2/c9-14-8(13)5-3-16-7(12-5)4-2-15-6(1-10)11-4/h2-3H,1,10H2 |
| InChIKey | UARIVTDESMCADO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|