C8H6N4O4 — CID 67853434
3-(2,4-dioxopyrimidin-1-yl)-1H-pyrimidine-2,4-dione (PubChem CID 67853434) has the molecular formula C8H6N4O4 and a molecular weight of 222.16 g/mol. Its IUPAC name is 3-(2,4-dioxopyrimidin-1-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(2,4-dioxopyrimidin-1-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67853434 |
| Molecular Formula | C8H6N4O4 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 3-(2,4-dioxopyrimidin-1-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1ccn(-n2c(=O)cc[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H6N4O4/c13-5-2-4-11(8(16)10-5)12-6(14)1-3-9-7(12)15/h1-4H,(H,9,15)(H,10,13,16) |
| InChIKey | MYLAYTGYEPUPRQ-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |