About 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid
2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid (PubChem CID 67854668) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| PubChem CID | 67854668 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| SMILES | CC1(C)C=CC=CC1OCC(=O)O |
| InChI | InChI=1S/C10H14O3/c1-10(2)6-4-3-5-8(10)13-7-9(11)12/h3-6,8H,7H2,1-2H3,(H,11,12) |
| InChIKey | NAXUIIYZENMOMB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The IUPAC name of 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid (CID 67854668) is 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
What is the SMILES notation for 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The canonical SMILES for 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid is CC1(C)C=CC=CC1OCC(=O)O.
What is the InChIKey of 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The InChIKey is NAXUIIYZENMOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-10(2)6-4-3-5-8(10)13-7-9(11)12/h3-6,8H,7H2,1-2H3,(H,11,12).
What are the key properties of 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid has a molecular weight of 182.22 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)oxyacetic acid is sourced from PubChem (CID 67854668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).