C25H33ClN2O3 — CID 67855868
8-[4-[(3aS,8bS)-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl]but-2-enyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride (PubChem CID 67855868) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is 8-[4-[(3aS,8bS)-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl]but-2-enyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride.
| Compound Name | 8-[4-[(3aS,8bS)-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl]but-2-enyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride |
|---|---|
| PubChem CID | 67855868 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 8-[4-[(3aS,8bS)-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl]but-2-enyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride |
| SMILES | COC1c2ccccc2[C@H]2CN(CC=CCN3C(=O)CC4(CCCC4)CC3=O)C[C@@H]12.Cl |
| InChI | InChI=1S/C25H32N2O3.ClH/c1-30-24-19-9-3-2-8-18(19)20-16-26(17-21(20)24)12-6-7-13-27-22(28)14-25(15-23(27)29)10-4-5-11-25;/h2-3,6-9,20-21,24H,4-5,10-17H2,1H3;1H/t20-,21-,24?;/m1./s1 |
| InChIKey | FBRXBRODXPELBV-QEOYLPEKSA-N |
| XLogP | 4.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|