C15H20O — CID 67862425
3,5,5-tris(prop-2-enyl)cyclohex-3-en-1-one (PubChem CID 67862425) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 3,5,5-tris(prop-2-enyl)cyclohex-3-en-1-one.
| Compound Name | 3,5,5-tris(prop-2-enyl)cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 67862425 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3,5,5-tris(prop-2-enyl)cyclohex-3-en-1-one |
| SMILES | C=CCC1=CC(CC=C)(CC=C)CC(=O)C1 |
| InChI | InChI=1S/C15H20O/c1-4-7-13-10-14(16)12-15(11-13,8-5-2)9-6-3/h4-6,11H,1-3,7-10,12H2 |
| InChIKey | ZFROYGGFTMHXJT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|