C24H36N2O5 — CID 67865577
(5-oxo-5-phenylmethoxypentyl) (2S)-1-[2-oxo-2-(pentylamino)ethyl]pyrrolidine-2-carboxylate (PubChem CID 67865577) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is (5-oxo-5-phenylmethoxypentyl) (2S)-1-[2-oxo-2-(pentylamino)ethyl]pyrrolidine-2-carboxylate.
| Compound Name | (5-oxo-5-phenylmethoxypentyl) (2S)-1-[2-oxo-2-(pentylamino)ethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67865577 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | (5-oxo-5-phenylmethoxypentyl) (2S)-1-[2-oxo-2-(pentylamino)ethyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCNC(=O)CN1CCC[C@H]1C(=O)OCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H36N2O5/c1-2-3-8-15-25-22(27)18-26-16-10-13-21(26)24(29)30-17-9-7-14-23(28)31-19-20-11-5-4-6-12-20/h4-6,11-12,21H,2-3,7-10,13-19H2,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | OIWZSCNCPXFZID-NRFANRHFSA-N |
| XLogP | 3.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|