C22H22N2O5S — CID 67867819
8-(2-methoxyethoxymethoxy)-4-methyl-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylic acid (PubChem CID 67867819) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 8-(2-methoxyethoxymethoxy)-4-methyl-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylic acid.
| Compound Name | 8-(2-methoxyethoxymethoxy)-4-methyl-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 67867819 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 8-(2-methoxyethoxymethoxy)-4-methyl-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxylic acid |
| SMILES | COCCOCOc1ccc2c(c1)-c1c(c(C(=O)O)nn1-c1ccccc1)C(C)S2 |
| InChI | InChI=1S/C22H22N2O5S/c1-14-19-20(22(25)26)23-24(15-6-4-3-5-7-15)21(19)17-12-16(8-9-18(17)30-14)29-13-28-11-10-27-2/h3-9,12,14H,10-11,13H2,1-2H3,(H,25,26) |
| InChIKey | MWICCVFOMXBXCT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|