C30H43N5O3 — CID 67872282
[1-[(2-amino-2-phenylethyl)amino]-2-(2H-indazol-3-ylmethyl)-4-methyl-1-oxododecan-2-yl] carbamate (PubChem CID 67872282) has the molecular formula C30H43N5O3 and a molecular weight of 521.71 g/mol. Its IUPAC name is [1-[(2-amino-2-phenylethyl)amino]-2-(2H-indazol-3-ylmethyl)-4-methyl-1-oxododecan-2-yl] carbamate.
| Compound Name | [1-[(2-amino-2-phenylethyl)amino]-2-(2H-indazol-3-ylmethyl)-4-methyl-1-oxododecan-2-yl] carbamate |
|---|---|
| PubChem CID | 67872282 |
| Molecular Formula | C30H43N5O3 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | [1-[(2-amino-2-phenylethyl)amino]-2-(2H-indazol-3-ylmethyl)-4-methyl-1-oxododecan-2-yl] carbamate |
| SMILES | CCCCCCCCC(C)CC(Cc1[nH]nc2ccccc12)(OC(N)=O)C(=O)NCC(N)c1ccccc1 |
| InChI | InChI=1S/C30H43N5O3/c1-3-4-5-6-7-9-14-22(2)19-30(38-29(32)37,20-27-24-17-12-13-18-26(24)34-35-27)28(36)33-21-25(31)23-15-10-8-11-16-23/h8,10-13,15-18,22,25H,3-7,9,14,19-21,31H2,1-2H3,(H2,32,37)(H,33,36)(H,34,35) |
| InChIKey | BFFLNVRXMWUFOM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|